C7H5BrF2O2S — CID 116838346
3-(5-bromothiophen-2-yl)-3,3-difluoropropanoic acid (PubChem CID 116838346) has the molecular formula C7H5BrF2O2S and a molecular weight of 271.08 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-3,3-difluoropropanoic acid.
| Compound Name | 3-(5-bromothiophen-2-yl)-3,3-difluoropropanoic acid |
|---|---|
| PubChem CID | 116838346 |
| Molecular Formula | C7H5BrF2O2S |
| Molecular Weight | 271.08 g/mol |
| Exact Mass | 269.92 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-3,3-difluoropropanoic acid |
| SMILES | O=C(O)CC(F)(F)c1ccc(Br)s1 |
| InChI | InChI=1S/C7H5BrF2O2S/c8-5-2-1-4(13-5)7(9,10)3-6(11)12/h1-2H,3H2,(H,11,12) |
| InChIKey | UFWGGVDNQMBJCB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.08 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |