C12H16BrF3O3SSi — CID 178130730
ethyl 2-(5-bromothiophen-2-yl)-3,3,3-trifluoro-2-trimethylsilyloxypropanoate (PubChem CID 178130730) has the molecular formula C12H16BrF3O3SSi and a molecular weight of 405.31 g/mol. Its IUPAC name is ethyl 2-(5-bromothiophen-2-yl)-3,3,3-trifluoro-2-trimethylsilyloxypropanoate.
| Compound Name | ethyl 2-(5-bromothiophen-2-yl)-3,3,3-trifluoro-2-trimethylsilyloxypropanoate |
|---|---|
| PubChem CID | 178130730 |
| Molecular Formula | C12H16BrF3O3SSi |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | ethyl 2-(5-bromothiophen-2-yl)-3,3,3-trifluoro-2-trimethylsilyloxypropanoate |
| SMILES | CCOC(=O)C(O[Si](C)(C)C)(c1ccc(Br)s1)C(F)(F)F |
| InChI | InChI=1S/C12H16BrF3O3SSi/c1-5-18-10(17)11(12(14,15)16,19-21(2,3)4)8-6-7-9(13)20-8/h6-7H,5H2,1-4H3 |
| InChIKey | KOAZAXAJIQOADG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|