C17H15BrN2 — CID 130501844
1-(benzylamino)-6-bromo-2,3-dihydroindene-1-carbonitrile (PubChem CID 130501844) has the molecular formula C17H15BrN2 and a molecular weight of 327.23 g/mol. Its IUPAC name is 1-(benzylamino)-6-bromo-2,3-dihydroindene-1-carbonitrile.
| Compound Name | 1-(benzylamino)-6-bromo-2,3-dihydroindene-1-carbonitrile |
|---|---|
| PubChem CID | 130501844 |
| Molecular Formula | C17H15BrN2 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 1-(benzylamino)-6-bromo-2,3-dihydroindene-1-carbonitrile |
| SMILES | N#CC1(NCc2ccccc2)CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C17H15BrN2/c18-15-7-6-14-8-9-17(12-19,16(14)10-15)20-11-13-4-2-1-3-5-13/h1-7,10,20H,8-9,11H2 |
| InChIKey | NTIRBXNZBIGTJH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |