C10H21FN2 — CID 130504644
1-(2-fluoroethyl)-4,6-dimethyl-1,5-diazocane (PubChem CID 130504644) has the molecular formula C10H21FN2 and a molecular weight of 188.29 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-4,6-dimethyl-1,5-diazocane.
| Compound Name | 1-(2-fluoroethyl)-4,6-dimethyl-1,5-diazocane |
|---|---|
| PubChem CID | 130504644 |
| Molecular Formula | C10H21FN2 |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.17 |
| IUPAC Name | 1-(2-fluoroethyl)-4,6-dimethyl-1,5-diazocane |
| SMILES | CC1CCN(CCF)CCC(C)N1 |
| InChI | InChI=1S/C10H21FN2/c1-9-3-6-13(8-5-11)7-4-10(2)12-9/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | LUHGIWMFJLZCSL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |