C7H16N2 — CID 45087354
(2R,4S)-1,2,4-trimethyl-1,3-diazinane (PubChem CID 45087354) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is (2R,4S)-1,2,4-trimethyl-1,3-diazinane.
| Compound Name | (2R,4S)-1,2,4-trimethyl-1,3-diazinane |
|---|---|
| PubChem CID | 45087354 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | (2R,4S)-1,2,4-trimethyl-1,3-diazinane |
| SMILES | C[C@@H]1N[C@@H](C)CCN1C |
| InChI | InChI=1S/C7H16N2/c1-6-4-5-9(3)7(2)8-6/h6-8H,4-5H2,1-3H3/t6-,7+/m0/s1 |
| InChIKey | WSJRBDXRBCLXPK-NKWVEPMBSA-N |
| XLogP | 0.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |