C5H12N2S — CID 68732880
2,5-dimethyl-1,2,6-thiadiazinane (PubChem CID 68732880) has the molecular formula C5H12N2S and a molecular weight of 132.23 g/mol. Its IUPAC name is 2,5-dimethyl-1,2,6-thiadiazinane.
| Compound Name | 2,5-dimethyl-1,2,6-thiadiazinane |
|---|---|
| PubChem CID | 68732880 |
| Molecular Formula | C5H12N2S |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 2,5-dimethyl-1,2,6-thiadiazinane |
| SMILES | CC1CCN(C)SN1 |
| InChI | InChI=1S/C5H12N2S/c1-5-3-4-7(2)8-6-5/h5-6H,3-4H2,1-2H3 |
| InChIKey | QBMXHIRSRNLCQE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|