C9H22N2O — CID 142873717
4,7-dimethyl-1,4-diazepan-2-ol;ethane (PubChem CID 142873717) has the molecular formula C9H22N2O and a molecular weight of 174.29 g/mol. Its IUPAC name is 4,7-dimethyl-1,4-diazepan-2-ol;ethane.
| Compound Name | 4,7-dimethyl-1,4-diazepan-2-ol;ethane |
|---|---|
| PubChem CID | 142873717 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | 4,7-dimethyl-1,4-diazepan-2-ol;ethane |
| SMILES | CC.CC1CCN(C)CC(O)N1 |
| InChI | InChI=1S/C7H16N2O.C2H6/c1-6-3-4-9(2)5-7(10)8-6;1-2/h6-8,10H,3-5H2,1-2H3;1-2H3 |
| InChIKey | JZUBUJHBCLDXBL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |