C10H26N2 — CID 167500512
1,3-dimethylpiperazine;ethane (PubChem CID 167500512) has the molecular formula C10H26N2 and a molecular weight of 174.33 g/mol. Its IUPAC name is 1,3-dimethylpiperazine;ethane.
| Compound Name | 1,3-dimethylpiperazine;ethane |
|---|---|
| PubChem CID | 167500512 |
| Molecular Formula | C10H26N2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.21 |
| IUPAC Name | 1,3-dimethylpiperazine;ethane |
| SMILES | CC.CC.CC1CN(C)CCN1 |
| InChI | InChI=1S/C6H14N2.2C2H6/c1-6-5-8(2)4-3-7-6;2*1-2/h6-7H,3-5H2,1-2H3;2*1-2H3 |
| InChIKey | FAOUGQQAJPEXLJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |