C6H16N2 — CID 145424168
(3R)-1,3-dimethylpiperazine;molecular hydrogen (PubChem CID 145424168) has the molecular formula C6H16N2 and a molecular weight of 116.21 g/mol. Its IUPAC name is (3R)-1,3-dimethylpiperazine;molecular hydrogen.
| Compound Name | (3R)-1,3-dimethylpiperazine;molecular hydrogen |
|---|---|
| PubChem CID | 145424168 |
| Molecular Formula | C6H16N2 |
| Molecular Weight | 116.21 g/mol |
| Exact Mass | 116.13 |
| IUPAC Name | (3R)-1,3-dimethylpiperazine;molecular hydrogen |
| SMILES | C[C@@H]1CN(C)CCN1.[H][H] |
| InChI | InChI=1S/C6H14N2.H2/c1-6-5-8(2)4-3-7-6;/h6-7H,3-5H2,1-2H3;1H/t6-;/m1./s1 |
| InChIKey | NQZTUBQQCSSFBF-FYZOBXCZSA-N |
| XLogP | 0.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |