(3R)-1,3-dimethylpiperazine;molecular hydrogen

C6H16N2 — CID 145424168

IUPAC(3R)-1,3-dimethylpiperazine;molecular hydrogen
SMILESC[C@@H]1CN(C)CCN1.[H][H]
InChIInChI=1S/C6H14N2.H2/c1-6-5-8(2)4-3-7-6;/h6-7H,3-5H2,1-2H3;1H/t6-;/m1./s1
InChIKeyNQZTUBQQCSSFBF-FYZOBXCZSA-N
MW116.21 g/mol
LogP0.16
Rot. Bonds

About (3R)-1,3-dimethylpiperazine;molecular hydrogen

(3R)-1,3-dimethylpiperazine;molecular hydrogen (PubChem CID 145424168) has the molecular formula C6H16N2 and a molecular weight of 116.21 g/mol. Its IUPAC name is (3R)-1,3-dimethylpiperazine;molecular hydrogen.

Molecular Properties

Compound Name(3R)-1,3-dimethylpiperazine;molecular hydrogen
PubChem CID145424168
Molecular FormulaC6H16N2
Molecular Weight116.21 g/mol
Exact Mass116.13
IUPAC Name(3R)-1,3-dimethylpiperazine;molecular hydrogen
SMILESC[C@@H]1CN(C)CCN1.[H][H]
InChIInChI=1S/C6H14N2.H2/c1-6-5-8(2)4-3-7-6;/h6-7H,3-5H2,1-2H3;1H/t6-;/m1./s1
InChIKeyNQZTUBQQCSSFBF-FYZOBXCZSA-N
XLogP0.16
TPSA15.27 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500116.21
LogP ≤ 50.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (3R)-1,3-dimethylpiperazine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-1,3-dimethylpiperazine;molecular hydrogen?
The IUPAC name of (3R)-1,3-dimethylpiperazine;molecular hydrogen (CID 145424168) is (3R)-1,3-dimethylpiperazine;molecular hydrogen.
What is the SMILES notation for (3R)-1,3-dimethylpiperazine;molecular hydrogen?
The canonical SMILES for (3R)-1,3-dimethylpiperazine;molecular hydrogen is C[C@@H]1CN(C)CCN1.[H][H].
What is the InChIKey of (3R)-1,3-dimethylpiperazine;molecular hydrogen?
The InChIKey is NQZTUBQQCSSFBF-FYZOBXCZSA-N. The full InChI is InChI=1S/C6H14N2.H2/c1-6-5-8(2)4-3-7-6;/h6-7H,3-5H2,1-2H3;1H/t6-;/m1./s1.
What are the key properties of (3R)-1,3-dimethylpiperazine;molecular hydrogen?
(3R)-1,3-dimethylpiperazine;molecular hydrogen has a molecular weight of 116.21 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1,3-dimethylpiperazine;molecular hydrogen is sourced from PubChem (CID 145424168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).