C10H25ClN4 — CID 174960389
1,3-dimethylpiperazine;piperazine;hydrochloride (PubChem CID 174960389) has the molecular formula C10H25ClN4 and a molecular weight of 236.79 g/mol. Its IUPAC name is 1,3-dimethylpiperazine;piperazine;hydrochloride.
| Compound Name | 1,3-dimethylpiperazine;piperazine;hydrochloride |
|---|---|
| PubChem CID | 174960389 |
| Molecular Formula | C10H25ClN4 |
| Molecular Weight | 236.79 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1,3-dimethylpiperazine;piperazine;hydrochloride |
| SMILES | C1CNCCN1.CC1CN(C)CCN1.Cl |
| InChI | InChI=1S/C6H14N2.C4H10N2.ClH/c1-6-5-8(2)4-3-7-6;1-2-6-4-3-5-1;/h6-7H,3-5H2,1-2H3;5-6H,1-4H2;1H |
| InChIKey | FFZUKJULBYGERO-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.79 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |