C8H20N2 — CID 143846249
(3R)-1,3-dimethylpiperazine;ethane (PubChem CID 143846249) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is (3R)-1,3-dimethylpiperazine;ethane.
| Compound Name | (3R)-1,3-dimethylpiperazine;ethane |
|---|---|
| PubChem CID | 143846249 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | (3R)-1,3-dimethylpiperazine;ethane |
| SMILES | CC.C[C@@H]1CN(C)CCN1 |
| InChI | InChI=1S/C6H14N2.C2H6/c1-6-5-8(2)4-3-7-6;1-2/h6-7H,3-5H2,1-2H3;1-2H3/t6-;/m1./s1 |
| InChIKey | HJHGUFGLMJEUNY-FYZOBXCZSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |