C10H13NS — CID 130506700
5-(5-methylthiophen-3-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 130506700) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 5-(5-methylthiophen-3-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 5-(5-methylthiophen-3-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 130506700 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 5-(5-methylthiophen-3-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | Cc1cc(C2=CCCNC2)cs1 |
| InChI | InChI=1S/C10H13NS/c1-8-5-10(7-12-8)9-3-2-4-11-6-9/h3,5,7,11H,2,4,6H2,1H3 |
| InChIKey | VBNRMIRNGBAXSO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |