C12H20N2 — CID 130507574
2,6-dimethyl-N-(3-methylbutan-2-yl)pyridin-4-amine (PubChem CID 130507574) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2,6-dimethyl-N-(3-methylbutan-2-yl)pyridin-4-amine.
| Compound Name | 2,6-dimethyl-N-(3-methylbutan-2-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 130507574 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2,6-dimethyl-N-(3-methylbutan-2-yl)pyridin-4-amine |
| SMILES | Cc1cc(NC(C)C(C)C)cc(C)n1 |
| InChI | InChI=1S/C12H20N2/c1-8(2)11(5)14-12-6-9(3)13-10(4)7-12/h6-8,11H,1-5H3,(H,13,14) |
| InChIKey | BBHPVMKOZRQSER-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |