C8H18N2O3S — CID 130519310
(4-methoxy-1-methylsulfonylpiperidin-4-yl)methanamine (PubChem CID 130519310) has the molecular formula C8H18N2O3S and a molecular weight of 222.31 g/mol. Its IUPAC name is (4-methoxy-1-methylsulfonylpiperidin-4-yl)methanamine.
| Compound Name | (4-methoxy-1-methylsulfonylpiperidin-4-yl)methanamine |
|---|---|
| PubChem CID | 130519310 |
| Molecular Formula | C8H18N2O3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (4-methoxy-1-methylsulfonylpiperidin-4-yl)methanamine |
| SMILES | COC1(CN)CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C8H18N2O3S/c1-13-8(7-9)3-5-10(6-4-8)14(2,11)12/h3-7,9H2,1-2H3 |
| InChIKey | PTAZOFDHRSTYAL-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |