C9H14N2S2 — CID 130519810
4-methyl-N-(1,3-thiazol-2-ylmethyl)thiolan-3-amine (PubChem CID 130519810) has the molecular formula C9H14N2S2 and a molecular weight of 214.36 g/mol. Its IUPAC name is 4-methyl-N-(1,3-thiazol-2-ylmethyl)thiolan-3-amine.
| Compound Name | 4-methyl-N-(1,3-thiazol-2-ylmethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 130519810 |
| Molecular Formula | C9H14N2S2 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 4-methyl-N-(1,3-thiazol-2-ylmethyl)thiolan-3-amine |
| SMILES | CC1CSCC1NCc1nccs1 |
| InChI | InChI=1S/C9H14N2S2/c1-7-5-12-6-8(7)11-4-9-10-2-3-13-9/h2-3,7-8,11H,4-6H2,1H3 |
| InChIKey | DCYKZUYLBULVGG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |