C8H14N2S — CID 130520007
3-(ethylamino)-4-methylthiolane-3-carbonitrile (PubChem CID 130520007) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 3-(ethylamino)-4-methylthiolane-3-carbonitrile.
| Compound Name | 3-(ethylamino)-4-methylthiolane-3-carbonitrile |
|---|---|
| PubChem CID | 130520007 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 3-(ethylamino)-4-methylthiolane-3-carbonitrile |
| SMILES | CCNC1(C#N)CSCC1C |
| InChI | InChI=1S/C8H14N2S/c1-3-10-8(5-9)6-11-4-7(8)2/h7,10H,3-4,6H2,1-2H3 |
| InChIKey | KSAVDSDPWBIKLK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |