C6H6ClN5O — CID 130521052
3-(chloromethyl)-5-(2-methyltriazol-4-yl)-1,2,4-oxadiazole (PubChem CID 130521052) has the molecular formula C6H6ClN5O and a molecular weight of 199.60 g/mol. Its IUPAC name is 3-(chloromethyl)-5-(2-methyltriazol-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(chloromethyl)-5-(2-methyltriazol-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 130521052 |
| Molecular Formula | C6H6ClN5O |
| Molecular Weight | 199.60 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | 3-(chloromethyl)-5-(2-methyltriazol-4-yl)-1,2,4-oxadiazole |
| SMILES | Cn1ncc(-c2nc(CCl)no2)n1 |
| InChI | InChI=1S/C6H6ClN5O/c1-12-8-3-4(10-12)6-9-5(2-7)11-13-6/h3H,2H2,1H3 |
| InChIKey | ZNYFSFJWGQBRKV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.60 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|