About 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane
6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane (PubChem CID 130529084) has the molecular formula C11H23NS
and a molecular weight of 201.38 g/mol. Its IUPAC name is 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane.
Molecular Properties
| Compound Name | 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane |
| PubChem CID | 130529084 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane |
| SMILES | CC1CCNC(C(C)C)(C(C)C)S1 |
| InChI | InChI=1S/C11H23NS/c1-8(2)11(9(3)4)12-7-6-10(5)13-11/h8-10,12H,6-7H2,1-5H3 |
| InChIKey | VVHMDTABAQRVKN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane?
The IUPAC name of 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane (CID 130529084) is 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane.
What is the SMILES notation for 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane?
The canonical SMILES for 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane is CC1CCNC(C(C)C)(C(C)C)S1.
What is the InChIKey of 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane?
The InChIKey is VVHMDTABAQRVKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NS/c1-8(2)11(9(3)4)12-7-6-10(5)13-11/h8-10,12H,6-7H2,1-5H3.
What are the key properties of 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane?
6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane has a molecular weight of 201.38 g/mol, XLogP of 3.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane is sourced from PubChem (CID 130529084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).