C11H23NS — CID 130529084
6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane (PubChem CID 130529084) has the molecular formula C11H23NS and a molecular weight of 201.38 g/mol. Its IUPAC name is 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane.
| Compound Name | 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane |
|---|---|
| PubChem CID | 130529084 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 6-methyl-2,2-di(propan-2-yl)-1,3-thiazinane |
| SMILES | CC1CCNC(C(C)C)(C(C)C)S1 |
| InChI | InChI=1S/C11H23NS/c1-8(2)11(9(3)4)12-7-6-10(5)13-11/h8-10,12H,6-7H2,1-5H3 |
| InChIKey | VVHMDTABAQRVKN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |