C8H16OS — CID 131854769
(2R,4S)-2,4-dimethyl-2-propan-2-yl-1,3-oxathiolane (PubChem CID 131854769) has the molecular formula C8H16OS and a molecular weight of 160.28 g/mol. Its IUPAC name is (2R,4S)-2,4-dimethyl-2-propan-2-yl-1,3-oxathiolane.
| Compound Name | (2R,4S)-2,4-dimethyl-2-propan-2-yl-1,3-oxathiolane |
|---|---|
| PubChem CID | 131854769 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (2R,4S)-2,4-dimethyl-2-propan-2-yl-1,3-oxathiolane |
| SMILES | CC(C)[C@]1(C)OC[C@H](C)S1 |
| InChI | InChI=1S/C8H16OS/c1-6(2)8(4)9-5-7(3)10-8/h6-7H,5H2,1-4H3/t7-,8+/m0/s1 |
| InChIKey | DSOFCEYCLIYWLF-JGVFFNPUSA-N |
| XLogP | 2.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |