About (4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane
(4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane (PubChem CID 176679204) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is (4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane.
Molecular Properties
| Compound Name | (4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane |
| PubChem CID | 176679204 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane |
| SMILES | COC1(C)[C@H](C)COC1(C)C(C)C |
| InChI | InChI=1S/C11H22O2/c1-8(2)10(4)11(5,12-6)9(3)7-13-10/h8-9H,7H2,1-6H3/t9-,10?,11?/m1/s1 |
| InChIKey | IGNMMOWMKKVPNK-KPPDAEKUSA-N |
| XLogP | 2.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane?
The IUPAC name of (4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane (CID 176679204) is (4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane.
What is the SMILES notation for (4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane?
The canonical SMILES for (4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane is COC1(C)[C@H](C)COC1(C)C(C)C.
What is the InChIKey of (4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane?
The InChIKey is IGNMMOWMKKVPNK-KPPDAEKUSA-N. The full InChI is InChI=1S/C11H22O2/c1-8(2)10(4)11(5,12-6)9(3)7-13-10/h8-9H,7H2,1-6H3/t9-,10?,11?/m1/s1.
What are the key properties of (4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane?
(4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane has a molecular weight of 186.29 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3-methoxy-2,3,4-trimethyl-2-propan-2-yloxolane is sourced from PubChem (CID 176679204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).