C12H22O3 — CID 21349615
4-methoxy-4,8-dimethyl-6-propan-2-yl-1,7-dioxaspiro[2.5]octane (PubChem CID 21349615) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 4-methoxy-4,8-dimethyl-6-propan-2-yl-1,7-dioxaspiro[2.5]octane.
| Compound Name | 4-methoxy-4,8-dimethyl-6-propan-2-yl-1,7-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 21349615 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 4-methoxy-4,8-dimethyl-6-propan-2-yl-1,7-dioxaspiro[2.5]octane |
| SMILES | COC1(C)CC(C(C)C)OC(C)C12CO2 |
| InChI | InChI=1S/C12H22O3/c1-8(2)10-6-11(4,13-5)12(7-14-12)9(3)15-10/h8-10H,6-7H2,1-5H3 |
| InChIKey | GVAYIDXZLPVLFL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|