C9H19O4P — CID 143759548
4,6-dimethoxy-2,4-dimethyl-3-phosphanyloxan-3-ol (PubChem CID 143759548) has the molecular formula C9H19O4P and a molecular weight of 222.22 g/mol. Its IUPAC name is 4,6-dimethoxy-2,4-dimethyl-3-phosphanyloxan-3-ol.
| Compound Name | 4,6-dimethoxy-2,4-dimethyl-3-phosphanyloxan-3-ol |
|---|---|
| PubChem CID | 143759548 |
| Molecular Formula | C9H19O4P |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 4,6-dimethoxy-2,4-dimethyl-3-phosphanyloxan-3-ol |
| SMILES | COC1CC(C)(OC)C(O)(P)C(C)O1 |
| InChI | InChI=1S/C9H19O4P/c1-6-9(10,14)8(2,12-4)5-7(11-3)13-6/h6-7,10H,5,14H2,1-4H3 |
| InChIKey | SHTAENLVYPVUMB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|