C9H14O4 — CID 134385542
5-ethenyl-7-methoxy-1,6-dioxaspiro[2.5]octan-4-ol (PubChem CID 134385542) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 5-ethenyl-7-methoxy-1,6-dioxaspiro[2.5]octan-4-ol.
| Compound Name | 5-ethenyl-7-methoxy-1,6-dioxaspiro[2.5]octan-4-ol |
|---|---|
| PubChem CID | 134385542 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 5-ethenyl-7-methoxy-1,6-dioxaspiro[2.5]octan-4-ol |
| SMILES | C=CC1OC(OC)CC2(CO2)C1O |
| InChI | InChI=1S/C9H14O4/c1-3-6-8(10)9(5-12-9)4-7(11-2)13-6/h3,6-8,10H,1,4-5H2,2H3 |
| InChIKey | MXNAGYAWNRFLCF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|