C18H28O6 — CID 148553580
(4S,5S,7R)-7-ethyl-5-[(E)-2-[(4S,5S,7R)-7-ethyl-4-hydroxy-1,6-dioxaspiro[2.5]octan-5-yl]ethenyl]-1,6-dioxaspiro[2.5]octan-4-ol (PubChem CID 148553580) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is (4S,5S,7R)-7-ethyl-5-[(E)-2-[(4S,5S,7R)-7-ethyl-4-hydroxy-1,6-dioxaspiro[2.5]octan-5-yl]ethenyl]-1,6-dioxaspiro[2.5]octan-4-ol.
| Compound Name | (4S,5S,7R)-7-ethyl-5-[(E)-2-[(4S,5S,7R)-7-ethyl-4-hydroxy-1,6-dioxaspiro[2.5]octan-5-yl]ethenyl]-1,6-dioxaspiro[2.5]octan-4-ol |
|---|---|
| PubChem CID | 148553580 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (4S,5S,7R)-7-ethyl-5-[(E)-2-[(4S,5S,7R)-7-ethyl-4-hydroxy-1,6-dioxaspiro[2.5]octan-5-yl]ethenyl]-1,6-dioxaspiro[2.5]octan-4-ol |
| SMILES | CC[C@@H]1CC2(CO2)[C@@H](O)[C@H](/C=C/[C@@H]2O[C@H](CC)CC3(CO3)[C@H]2O)O1 |
| InChI | InChI=1S/C18H28O6/c1-3-11-7-17(9-21-17)15(19)13(23-11)5-6-14-16(20)18(10-22-18)8-12(4-2)24-14/h5-6,11-16,19-20H,3-4,7-10H2,1-2H3/b6-5+/t11-,12-,13+,14+,15+,16+,17?,18?/m1/s1 |
| InChIKey | MTPZWVFOHNCAHW-KKKHWZKYSA-N |
| XLogP | 0.94 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|