C9H19NO4 — CID 22887274
(2R,3S,4R,6R)-4-(dimethylamino)-6-methoxy-2-methyloxane-3,4-diol (PubChem CID 22887274) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is (2R,3S,4R,6R)-4-(dimethylamino)-6-methoxy-2-methyloxane-3,4-diol.
| Compound Name | (2R,3S,4R,6R)-4-(dimethylamino)-6-methoxy-2-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 22887274 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (2R,3S,4R,6R)-4-(dimethylamino)-6-methoxy-2-methyloxane-3,4-diol |
| SMILES | CO[C@H]1C[C@](O)(N(C)C)[C@@H](O)[C@@H](C)O1 |
| InChI | InChI=1S/C9H19NO4/c1-6-8(11)9(12,10(2)3)5-7(13-4)14-6/h6-8,11-12H,5H2,1-4H3/t6-,7-,8+,9-/m1/s1 |
| InChIKey | NTMCPCFGHWNBDW-LURQLKTLSA-N |
| XLogP | -0.62 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|