C13H19NO6 — CID 146739977
methyl 2-[(3R,4R,5R,7S)-5-ethenyl-4-(methylcarbamoyloxy)-1,6-dioxaspiro[2.5]octan-7-yl]acetate (PubChem CID 146739977) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is methyl 2-[(3R,4R,5R,7S)-5-ethenyl-4-(methylcarbamoyloxy)-1,6-dioxaspiro[2.5]octan-7-yl]acetate.
| Compound Name | methyl 2-[(3R,4R,5R,7S)-5-ethenyl-4-(methylcarbamoyloxy)-1,6-dioxaspiro[2.5]octan-7-yl]acetate |
|---|---|
| PubChem CID | 146739977 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | methyl 2-[(3R,4R,5R,7S)-5-ethenyl-4-(methylcarbamoyloxy)-1,6-dioxaspiro[2.5]octan-7-yl]acetate |
| SMILES | C=C[C@H]1O[C@H](CC(=O)OC)C[C@@]2(CO2)[C@@H]1OC(=O)NC |
| InChI | InChI=1S/C13H19NO6/c1-4-9-11(20-12(16)14-2)13(7-18-13)6-8(19-9)5-10(15)17-3/h4,8-9,11H,1,5-7H2,2-3H3,(H,14,16)/t8-,9-,11-,13-/m1/s1 |
| InChIKey | RKINDORFSHMUFH-RUSTZOOPSA-N |
| XLogP | 0.39 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|