C5H10O4 — CID 11412410
(3R,5S)-5-methoxy-3-methyldioxolan-3-ol (PubChem CID 11412410) has the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. Its IUPAC name is (3R,5S)-5-methoxy-3-methyldioxolan-3-ol.
| Compound Name | (3R,5S)-5-methoxy-3-methyldioxolan-3-ol |
|---|---|
| PubChem CID | 11412410 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | (3R,5S)-5-methoxy-3-methyldioxolan-3-ol |
| SMILES | CO[C@@H]1C[C@](C)(O)OO1 |
| InChI | InChI=1S/C5H10O4/c1-5(6)3-4(7-2)8-9-5/h4,6H,3H2,1-2H3/t4-,5+/m0/s1 |
| InChIKey | CYMIXAAOCCDNEH-CRCLSJGQSA-N |
| XLogP | 0.02 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|