C6H12O4 — CID 119098312
(3S,6R)-6-methoxy-3-methyldioxan-3-ol (PubChem CID 119098312) has the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. Its IUPAC name is (3S,6R)-6-methoxy-3-methyldioxan-3-ol.
| Compound Name | (3S,6R)-6-methoxy-3-methyldioxan-3-ol |
|---|---|
| PubChem CID | 119098312 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | (3S,6R)-6-methoxy-3-methyldioxan-3-ol |
| SMILES | CO[C@H]1CC[C@@](C)(O)OO1 |
| InChI | InChI=1S/C6H12O4/c1-6(7)4-3-5(8-2)9-10-6/h5,7H,3-4H2,1-2H3/t5-,6+/m1/s1 |
| InChIKey | WNZFVERNQYOCJF-RITPCOANSA-N |
| XLogP | 0.41 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|