C9H16O3 — CID 148927647
(3S,3aS,6S,6aS)-3,3a,6a-trimethyl-2,3,5,6-tetrahydrofuro[3,2-b]furan-6-ol (PubChem CID 148927647) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (3S,3aS,6S,6aS)-3,3a,6a-trimethyl-2,3,5,6-tetrahydrofuro[3,2-b]furan-6-ol.
| Compound Name | (3S,3aS,6S,6aS)-3,3a,6a-trimethyl-2,3,5,6-tetrahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 148927647 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (3S,3aS,6S,6aS)-3,3a,6a-trimethyl-2,3,5,6-tetrahydrofuro[3,2-b]furan-6-ol |
| SMILES | C[C@H]1CO[C@@]2(C)[C@@H](O)CO[C@@]12C |
| InChI | InChI=1S/C9H16O3/c1-6-4-11-9(3)7(10)5-12-8(6,9)2/h6-7,10H,4-5H2,1-3H3/t6-,7-,8-,9-/m0/s1 |
| InChIKey | PLHNEWRLOMAVPE-JBDRJPRFSA-N |
| XLogP | 0.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |