C11H11N3O — CID 130529860
2-(2-ethyl-1,2,4-triazol-3-yl)benzaldehyde (PubChem CID 130529860) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 2-(2-ethyl-1,2,4-triazol-3-yl)benzaldehyde.
| Compound Name | 2-(2-ethyl-1,2,4-triazol-3-yl)benzaldehyde |
|---|---|
| PubChem CID | 130529860 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-(2-ethyl-1,2,4-triazol-3-yl)benzaldehyde |
| SMILES | CCn1ncnc1-c1ccccc1C=O |
| InChI | InChI=1S/C11H11N3O/c1-2-14-11(12-8-13-14)10-6-4-3-5-9(10)7-15/h3-8H,2H2,1H3 |
| InChIKey | HLEOEBLRLMSSSH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|