C9H15N3O — CID 130530013
3-(2-ethyl-1,2,4-triazol-3-yl)cyclopentan-1-ol (PubChem CID 130530013) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-(2-ethyl-1,2,4-triazol-3-yl)cyclopentan-1-ol.
| Compound Name | 3-(2-ethyl-1,2,4-triazol-3-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 130530013 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-(2-ethyl-1,2,4-triazol-3-yl)cyclopentan-1-ol |
| SMILES | CCn1ncnc1C1CCC(O)C1 |
| InChI | InChI=1S/C9H15N3O/c1-2-12-9(10-6-11-12)7-3-4-8(13)5-7/h6-8,13H,2-5H2,1H3 |
| InChIKey | USAGOVDYELIJEO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |