C11H16BrNS — CID 130539557
4-[(E)-3-bromobut-1-enyl]-2-tert-butyl-1,3-thiazole (PubChem CID 130539557) has the molecular formula C11H16BrNS and a molecular weight of 274.23 g/mol. Its IUPAC name is 4-[(E)-3-bromobut-1-enyl]-2-tert-butyl-1,3-thiazole.
| Compound Name | 4-[(E)-3-bromobut-1-enyl]-2-tert-butyl-1,3-thiazole |
|---|---|
| PubChem CID | 130539557 |
| Molecular Formula | C11H16BrNS |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 4-[(E)-3-bromobut-1-enyl]-2-tert-butyl-1,3-thiazole |
| SMILES | CC(Br)/C=C/c1csc(C(C)(C)C)n1 |
| InChI | InChI=1S/C11H16BrNS/c1-8(12)5-6-9-7-14-10(13-9)11(2,3)4/h5-8H,1-4H3/b6-5+ |
| InChIKey | VQDHXJFSKSQNAY-AATRIKPKSA-N |
| XLogP | 4.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|