About 3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine
3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 104863099) has the molecular formula C12H20N2S
and a molecular weight of 224.37 g/mol. Its IUPAC name is 3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine.
Molecular Properties
| Compound Name | 3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine |
| PubChem CID | 104863099 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | CNCC(C)=Cc1csc(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H20N2S/c1-9(7-13-5)6-10-8-15-11(14-10)12(2,3)4/h6,8,13H,7H2,1-5H3 |
| InChIKey | NIKBYKGSBGBGDF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine?
The IUPAC name of 3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine (CID 104863099) is 3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine.
What is the SMILES notation for 3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine?
The canonical SMILES for 3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine is CNCC(C)=Cc1csc(C(C)(C)C)n1.
What is the InChIKey of 3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine?
The InChIKey is NIKBYKGSBGBGDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2S/c1-9(7-13-5)6-10-8-15-11(14-10)12(2,3)4/h6,8,13H,7H2,1-5H3.
What are the key properties of 3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine?
3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine has a molecular weight of 224.37 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-tert-butyl-1,3-thiazol-4-yl)-N,2-dimethylprop-2-en-1-amine is sourced from PubChem (CID 104863099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).