C11H13NO2S — CID 130542787
5-(3-oxobutyl)-6,7-dihydrothieno[3,2-c]pyridin-4-one (PubChem CID 130542787) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 5-(3-oxobutyl)-6,7-dihydrothieno[3,2-c]pyridin-4-one.
| Compound Name | 5-(3-oxobutyl)-6,7-dihydrothieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 130542787 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 5-(3-oxobutyl)-6,7-dihydrothieno[3,2-c]pyridin-4-one |
| SMILES | CC(=O)CCN1CCc2sccc2C1=O |
| InChI | InChI=1S/C11H13NO2S/c1-8(13)2-5-12-6-3-10-9(11(12)14)4-7-15-10/h4,7H,2-3,5-6H2,1H3 |
| InChIKey | NUSOVIWOVLRQFE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |