C11H13NOS — CID 130542809
5-(2-methylprop-2-enyl)-6,7-dihydrothieno[3,2-c]pyridin-4-one (PubChem CID 130542809) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 5-(2-methylprop-2-enyl)-6,7-dihydrothieno[3,2-c]pyridin-4-one.
| Compound Name | 5-(2-methylprop-2-enyl)-6,7-dihydrothieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 130542809 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 5-(2-methylprop-2-enyl)-6,7-dihydrothieno[3,2-c]pyridin-4-one |
| SMILES | C=C(C)CN1CCc2sccc2C1=O |
| InChI | InChI=1S/C11H13NOS/c1-8(2)7-12-5-3-10-9(11(12)13)4-6-14-10/h4,6H,1,3,5,7H2,2H3 |
| InChIKey | SYYZPBGMLZLQSG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|