C9H15N3OS — CID 130550062
2-(aminomethyl)-2-(thiadiazol-4-ylmethyl)cyclopentan-1-ol (PubChem CID 130550062) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-(aminomethyl)-2-(thiadiazol-4-ylmethyl)cyclopentan-1-ol.
| Compound Name | 2-(aminomethyl)-2-(thiadiazol-4-ylmethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 130550062 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-(aminomethyl)-2-(thiadiazol-4-ylmethyl)cyclopentan-1-ol |
| SMILES | NCC1(Cc2csnn2)CCCC1O |
| InChI | InChI=1S/C9H15N3OS/c10-6-9(3-1-2-8(9)13)4-7-5-14-12-11-7/h5,8,13H,1-4,6,10H2 |
| InChIKey | YNCBQUXWYBJRBC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |