C7H8F2N4O — CID 130551008
2-amino-N-(2,2-difluoroethyl)pyrimidine-5-carboxamide (PubChem CID 130551008) has the molecular formula C7H8F2N4O and a molecular weight of 202.16 g/mol. Its IUPAC name is 2-amino-N-(2,2-difluoroethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-amino-N-(2,2-difluoroethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 130551008 |
| Molecular Formula | C7H8F2N4O |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-amino-N-(2,2-difluoroethyl)pyrimidine-5-carboxamide |
| SMILES | Nc1ncc(C(=O)NCC(F)F)cn1 |
| InChI | InChI=1S/C7H8F2N4O/c8-5(9)3-11-6(14)4-1-12-7(10)13-2-4/h1-2,5H,3H2,(H,11,14)(H2,10,12,13) |
| InChIKey | QGBMQAXPFRIXNA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |