C6H5BrF2N2OS — CID 167312017
2-bromo-N-(2,2-difluoroethyl)-1,3-thiazole-5-carboxamide (PubChem CID 167312017) has the molecular formula C6H5BrF2N2OS and a molecular weight of 271.09 g/mol. Its IUPAC name is 2-bromo-N-(2,2-difluoroethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-bromo-N-(2,2-difluoroethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 167312017 |
| Molecular Formula | C6H5BrF2N2OS |
| Molecular Weight | 271.09 g/mol |
| Exact Mass | 269.93 |
| IUPAC Name | 2-bromo-N-(2,2-difluoroethyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCC(F)F)c1cnc(Br)s1 |
| InChI | InChI=1S/C6H5BrF2N2OS/c7-6-11-1-3(13-6)5(12)10-2-4(8)9/h1,4H,2H2,(H,10,12) |
| InChIKey | JVELPNVAKBPBMK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.09 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |