C9H11N5 — CID 130551443
6-[[(E)-4-aminobut-2-enyl]amino]pyrimidine-4-carbonitrile (PubChem CID 130551443) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 6-[[(E)-4-aminobut-2-enyl]amino]pyrimidine-4-carbonitrile.
| Compound Name | 6-[[(E)-4-aminobut-2-enyl]amino]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 130551443 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 6-[[(E)-4-aminobut-2-enyl]amino]pyrimidine-4-carbonitrile |
| SMILES | N#Cc1cc(NC/C=C/CN)ncn1 |
| InChI | InChI=1S/C9H11N5/c10-3-1-2-4-12-9-5-8(6-11)13-7-14-9/h1-2,5,7H,3-4,10H2,(H,12,13,14)/b2-1+ |
| InChIKey | SHBLXHCUUIBSKS-OWOJBTEDSA-N |
| XLogP | 0.28 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|