C7H7FN4 — CID 130478010
6-(2-fluoroethylamino)pyrimidine-4-carbonitrile (PubChem CID 130478010) has the molecular formula C7H7FN4 and a molecular weight of 166.16 g/mol. Its IUPAC name is 6-(2-fluoroethylamino)pyrimidine-4-carbonitrile.
| Compound Name | 6-(2-fluoroethylamino)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 130478010 |
| Molecular Formula | C7H7FN4 |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 6-(2-fluoroethylamino)pyrimidine-4-carbonitrile |
| SMILES | N#Cc1cc(NCCF)ncn1 |
| InChI | InChI=1S/C7H7FN4/c8-1-2-10-7-3-6(4-9)11-5-12-7/h3,5H,1-2H2,(H,10,11,12) |
| InChIKey | MHSLVNZJSSHTAV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |