C14H16N4 — CID 167867833
6-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]pyrimidine-4-carbonitrile (PubChem CID 167867833) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 6-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]pyrimidine-4-carbonitrile.
| Compound Name | 6-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 167867833 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 6-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]pyrimidine-4-carbonitrile |
| SMILES | N#Cc1cc(NCC[C@@H]2C[C@@H]3C=C[C@H]2C3)ncn1 |
| InChI | InChI=1S/C14H16N4/c15-8-13-7-14(18-9-17-13)16-4-3-12-6-10-1-2-11(12)5-10/h1-2,7,9-12H,3-6H2,(H,16,17,18)/t10-,11+,12-/m1/s1 |
| InChIKey | UWTNSGNYLPCTBV-GRYCIOLGSA-N |
| XLogP | 2.36 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|