C9H13N5 — CID 130551444
6-[2-(methylamino)propylamino]pyrimidine-4-carbonitrile (PubChem CID 130551444) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is 6-[2-(methylamino)propylamino]pyrimidine-4-carbonitrile.
| Compound Name | 6-[2-(methylamino)propylamino]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 130551444 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 6-[2-(methylamino)propylamino]pyrimidine-4-carbonitrile |
| SMILES | CNC(C)CNc1cc(C#N)ncn1 |
| InChI | InChI=1S/C9H13N5/c1-7(11-2)5-12-9-3-8(4-10)13-6-14-9/h3,6-7,11H,5H2,1-2H3,(H,12,13,14) |
| InChIKey | PATPEQHNSPARIU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |