C13H21N3 — CID 122097285
N-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-5-methyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 122097285) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-5-methyl-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-5-methyl-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 122097285 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-[2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-5-methyl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CC1CN=C(NCCC2C[C@@H]3C=C[C@H]2C3)N1 |
| InChI | InChI=1S/C13H21N3/c1-9-8-15-13(16-9)14-5-4-12-7-10-2-3-11(12)6-10/h2-3,9-12H,4-8H2,1H3,(H2,14,15,16)/t9?,10-,11+,12?/m1/s1 |
| InChIKey | KRKDOPRECAXUTE-UPOSSJBDSA-N |
| XLogP | 1.53 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|