About (4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone
(4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone (PubChem CID 130553362) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is (4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone.
Molecular Properties
| Compound Name | (4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone |
| PubChem CID | 130553362 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone |
| SMILES | CC1(C(=O)N2CC(O)CO2)CC1 |
| InChI | InChI=1S/C8H13NO3/c1-8(2-3-8)7(11)9-4-6(10)5-12-9/h6,10H,2-5H2,1H3 |
| InChIKey | SMACNPXNPNQRND-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone?
The IUPAC name of (4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone (CID 130553362) is (4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone.
What is the SMILES notation for (4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone?
The canonical SMILES for (4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone is CC1(C(=O)N2CC(O)CO2)CC1.
What is the InChIKey of (4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone?
The InChIKey is SMACNPXNPNQRND-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-8(2-3-8)7(11)9-4-6(10)5-12-9/h6,10H,2-5H2,1H3.
What are the key properties of (4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone?
(4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone has a molecular weight of 171.20 g/mol, XLogP of -0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-1,2-oxazolidin-2-yl)-(1-methylcyclopropyl)methanone is sourced from PubChem (CID 130553362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).