About N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide
N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide (PubChem CID 130522721) has the molecular formula C7H12N2O4
and a molecular weight of 188.18 g/mol. Its IUPAC name is N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide |
| PubChem CID | 130522721 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)N1C[C@@H](O)CO1 |
| InChI | InChI=1S/C7H12N2O4/c1-5(10)8-2-7(12)9-3-6(11)4-13-9/h6,11H,2-4H2,1H3,(H,8,10)/t6-/m1/s1 |
| InChIKey | NNRLLNKWISTJEH-ZCFIWIBFSA-N |
| XLogP | -1.74 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide?
The IUPAC name of N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide (CID 130522721) is N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide.
What is the SMILES notation for N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide?
The canonical SMILES for N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide is CC(=O)NCC(=O)N1C[C@@H](O)CO1.
What is the InChIKey of N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide?
The InChIKey is NNRLLNKWISTJEH-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H12N2O4/c1-5(10)8-2-7(12)9-3-6(11)4-13-9/h6,11H,2-4H2,1H3,(H,8,10)/t6-/m1/s1.
What are the key properties of N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide?
N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide has a molecular weight of 188.18 g/mol, XLogP of -1.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]-2-oxoethyl]acetamide is sourced from PubChem (CID 130522721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).