C8H16N2O2 — CID 130559665
1-(1,4-dioxepan-6-yl)azetidin-3-amine (PubChem CID 130559665) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 1-(1,4-dioxepan-6-yl)azetidin-3-amine.
| Compound Name | 1-(1,4-dioxepan-6-yl)azetidin-3-amine |
|---|---|
| PubChem CID | 130559665 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 1-(1,4-dioxepan-6-yl)azetidin-3-amine |
| SMILES | NC1CN(C2COCCOC2)C1 |
| InChI | InChI=1S/C8H16N2O2/c9-7-3-10(4-7)8-5-11-1-2-12-6-8/h7-8H,1-6,9H2 |
| InChIKey | DPSCXXSTSRJHEA-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |