C10H20N2O2 — CID 130559661
1-(1,4-dioxepan-6-yl)piperidin-3-amine (PubChem CID 130559661) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-(1,4-dioxepan-6-yl)piperidin-3-amine.
| Compound Name | 1-(1,4-dioxepan-6-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 130559661 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 1-(1,4-dioxepan-6-yl)piperidin-3-amine |
| SMILES | NC1CCCN(C2COCCOC2)C1 |
| InChI | InChI=1S/C10H20N2O2/c11-9-2-1-3-12(6-9)10-7-13-4-5-14-8-10/h9-10H,1-8,11H2 |
| InChIKey | OVPZPSZPRZPQJW-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |