C6H10BrN5S — CID 130563777
1-amino-3-[2-(4-bromopyrazol-1-yl)ethyl]thiourea (PubChem CID 130563777) has the molecular formula C6H10BrN5S and a molecular weight of 264.15 g/mol. Its IUPAC name is 1-amino-3-[2-(4-bromopyrazol-1-yl)ethyl]thiourea.
| Compound Name | 1-amino-3-[2-(4-bromopyrazol-1-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 130563777 |
| Molecular Formula | C6H10BrN5S |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 1-amino-3-[2-(4-bromopyrazol-1-yl)ethyl]thiourea |
| SMILES | NNC(=S)NCCn1cc(Br)cn1 |
| InChI | InChI=1S/C6H10BrN5S/c7-5-3-10-12(4-5)2-1-9-6(13)11-8/h3-4H,1-2,8H2,(H2,9,11,13) |
| InChIKey | ASAGSMMXIKIONB-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|