About 5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol
5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol (PubChem CID 130564945) has the molecular formula C8H6F3NO
and a molecular weight of 189.14 g/mol. Its IUPAC name is 5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol.
Molecular Properties
| Compound Name | 5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol |
| PubChem CID | 130564945 |
| Molecular Formula | C8H6F3NO |
| Molecular Weight | 189.14 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol |
| SMILES | C=C(c1cncc(O)c1)C(F)(F)F |
| InChI | InChI=1S/C8H6F3NO/c1-5(8(9,10)11)6-2-7(13)4-12-3-6/h2-4,13H,1H2 |
| InChIKey | OSTBVCSKWNPJQR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.14 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol?
The IUPAC name of 5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol (CID 130564945) is 5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol.
What is the SMILES notation for 5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol?
The canonical SMILES for 5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol is C=C(c1cncc(O)c1)C(F)(F)F.
What is the InChIKey of 5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol?
The InChIKey is OSTBVCSKWNPJQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3NO/c1-5(8(9,10)11)6-2-7(13)4-12-3-6/h2-4,13H,1H2.
What are the key properties of 5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol?
5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol has a molecular weight of 189.14 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3,3-trifluoroprop-1-en-2-yl)pyridin-3-ol is sourced from PubChem (CID 130564945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).