C8H9ClN4O — CID 130566629
5-[[5-(chloromethyl)triazol-1-yl]methyl]-3-methyl-1,2-oxazole (PubChem CID 130566629) has the molecular formula C8H9ClN4O and a molecular weight of 212.64 g/mol. Its IUPAC name is 5-[[5-(chloromethyl)triazol-1-yl]methyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[[5-(chloromethyl)triazol-1-yl]methyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 130566629 |
| Molecular Formula | C8H9ClN4O |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 5-[[5-(chloromethyl)triazol-1-yl]methyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(Cn2nncc2CCl)on1 |
| InChI | InChI=1S/C8H9ClN4O/c1-6-2-8(14-11-6)5-13-7(3-9)4-10-12-13/h2,4H,3,5H2,1H3 |
| InChIKey | WYYGTILSQVOHSE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|